C17H14N2O3 — CID 108895519
1-(3,5-dihydroxyphenyl)-3-naphthalen-2-ylurea (PubChem CID 108895519) has the molecular formula C17H14N2O3 and a molecular weight of 294.31 g/mol. Its IUPAC name is 1-(3,5-dihydroxyphenyl)-3-naphthalen-2-ylurea.
| Compound Name | 1-(3,5-dihydroxyphenyl)-3-naphthalen-2-ylurea |
|---|---|
| PubChem CID | 108895519 |
| Molecular Formula | C17H14N2O3 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 1-(3,5-dihydroxyphenyl)-3-naphthalen-2-ylurea |
| SMILES | O=C(Nc1cc(O)cc(O)c1)Nc1ccc2ccccc2c1 |
| InChI | InChI=1S/C17H14N2O3/c20-15-8-14(9-16(21)10-15)19-17(22)18-13-6-5-11-3-1-2-4-12(11)7-13/h1-10,20-21H,(H2,18,19,22) |
| InChIKey | UVPKLSVCABCLRA-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |