C21H14Br2N2O2 — CID 90741170
1-(2,4-dibromo-7-hydroxynaphthalen-1-yl)-3-naphthalen-2-ylurea (PubChem CID 90741170) has the molecular formula C21H14Br2N2O2 and a molecular weight of 486.16 g/mol. Its IUPAC name is 1-(2,4-dibromo-7-hydroxynaphthalen-1-yl)-3-naphthalen-2-ylurea.
| Compound Name | 1-(2,4-dibromo-7-hydroxynaphthalen-1-yl)-3-naphthalen-2-ylurea |
|---|---|
| PubChem CID | 90741170 |
| Molecular Formula | C21H14Br2N2O2 |
| Molecular Weight | 486.16 g/mol |
| Exact Mass | 483.94 |
| IUPAC Name | 1-(2,4-dibromo-7-hydroxynaphthalen-1-yl)-3-naphthalen-2-ylurea |
| SMILES | O=C(Nc1ccc2ccccc2c1)Nc1c(Br)cc(Br)c2ccc(O)cc12 |
| InChI | InChI=1S/C21H14Br2N2O2/c22-18-11-19(23)20(17-10-15(26)7-8-16(17)18)25-21(27)24-14-6-5-12-3-1-2-4-13(12)9-14/h1-11,26H,(H2,24,25,27) |
| InChIKey | FZJUJFJBAUOMAH-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.16 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |