C12H11BrN2O — CID 146021922
1-(5-bromonaphthalen-2-yl)-3-methylurea (PubChem CID 146021922) has the molecular formula C12H11BrN2O and a molecular weight of 279.14 g/mol. Its IUPAC name is 1-(5-bromonaphthalen-2-yl)-3-methylurea.
| Compound Name | 1-(5-bromonaphthalen-2-yl)-3-methylurea |
|---|---|
| PubChem CID | 146021922 |
| Molecular Formula | C12H11BrN2O |
| Molecular Weight | 279.14 g/mol |
| Exact Mass | 278.01 |
| IUPAC Name | 1-(5-bromonaphthalen-2-yl)-3-methylurea |
| SMILES | CNC(=O)Nc1ccc2c(Br)cccc2c1 |
| InChI | InChI=1S/C12H11BrN2O/c1-14-12(16)15-9-5-6-10-8(7-9)3-2-4-11(10)13/h2-7H,1H3,(H2,14,15,16) |
| InChIKey | NSLHOYZUIKSZHW-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.14 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |