C21H17BrN2O — CID 146022021
N-(5-bromonaphthalen-2-yl)-2,3-dimethyl-1H-indole-7-carboxamide (PubChem CID 146022021) has the molecular formula C21H17BrN2O and a molecular weight of 393.28 g/mol. Its IUPAC name is N-(5-bromonaphthalen-2-yl)-2,3-dimethyl-1H-indole-7-carboxamide.
| Compound Name | N-(5-bromonaphthalen-2-yl)-2,3-dimethyl-1H-indole-7-carboxamide |
|---|---|
| PubChem CID | 146022021 |
| Molecular Formula | C21H17BrN2O |
| Molecular Weight | 393.28 g/mol |
| Exact Mass | 392.05 |
| IUPAC Name | N-(5-bromonaphthalen-2-yl)-2,3-dimethyl-1H-indole-7-carboxamide |
| SMILES | Cc1[nH]c2c(C(=O)Nc3ccc4c(Br)cccc4c3)cccc2c1C |
| InChI | InChI=1S/C21H17BrN2O/c1-12-13(2)23-20-16(12)6-4-7-18(20)21(25)24-15-9-10-17-14(11-15)5-3-8-19(17)22/h3-11,23H,1-2H3,(H,24,25) |
| InChIKey | VQDKCKSJOGUHSC-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.28 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|