C13H16N4O2 — CID 47383567
1-[(2,3-dimethyl-1H-indole-7-carbonyl)amino]-3-methylurea (PubChem CID 47383567) has the molecular formula C13H16N4O2 and a molecular weight of 260.30 g/mol. Its IUPAC name is 1-[(2,3-dimethyl-1H-indole-7-carbonyl)amino]-3-methylurea.
| Compound Name | 1-[(2,3-dimethyl-1H-indole-7-carbonyl)amino]-3-methylurea |
|---|---|
| PubChem CID | 47383567 |
| Molecular Formula | C13H16N4O2 |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | 1-[(2,3-dimethyl-1H-indole-7-carbonyl)amino]-3-methylurea |
| SMILES | CNC(=O)NNC(=O)c1cccc2c(C)c(C)[nH]c12 |
| InChI | InChI=1S/C13H16N4O2/c1-7-8(2)15-11-9(7)5-4-6-10(11)12(18)16-17-13(19)14-3/h4-6,15H,1-3H3,(H,16,18)(H2,14,17,19) |
| InChIKey | NMCPLCDCJYOAPU-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 86.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|