C17H20F2N2O — CID 154834919
N-(4,4-difluorocyclohexyl)-2,3-dimethyl-1H-indole-7-carboxamide (PubChem CID 154834919) has the molecular formula C17H20F2N2O and a molecular weight of 306.36 g/mol. Its IUPAC name is N-(4,4-difluorocyclohexyl)-2,3-dimethyl-1H-indole-7-carboxamide.
| Compound Name | N-(4,4-difluorocyclohexyl)-2,3-dimethyl-1H-indole-7-carboxamide |
|---|---|
| PubChem CID | 154834919 |
| Molecular Formula | C17H20F2N2O |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | N-(4,4-difluorocyclohexyl)-2,3-dimethyl-1H-indole-7-carboxamide |
| SMILES | Cc1[nH]c2c(C(=O)NC3CCC(F)(F)CC3)cccc2c1C |
| InChI | InChI=1S/C17H20F2N2O/c1-10-11(2)20-15-13(10)4-3-5-14(15)16(22)21-12-6-8-17(18,19)9-7-12/h3-5,12,20H,6-9H2,1-2H3,(H,21,22) |
| InChIKey | MWRIAAWUFNJUOK-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|