C11H10NO2- — CID 6950947
2,3-dimethyl-1H-indole-7-carboxylate (PubChem CID 6950947) has the molecular formula C11H10NO2- and a molecular weight of 188.21 g/mol. Its IUPAC name is 2,3-dimethyl-1H-indole-7-carboxylate.
| Compound Name | 2,3-dimethyl-1H-indole-7-carboxylate |
|---|---|
| PubChem CID | 6950947 |
| Molecular Formula | C11H10NO2- |
| Molecular Weight | 188.21 g/mol |
| Exact Mass | 188.07 |
| IUPAC Name | 2,3-dimethyl-1H-indole-7-carboxylate |
| SMILES | Cc1[nH]c2c(C(=O)[O-])cccc2c1C |
| InChI | InChI=1S/C11H11NO2/c1-6-7(2)12-10-8(6)4-3-5-9(10)11(13)14/h3-5,12H,1-2H3,(H,13,14)/p-1 |
| InChIKey | ITMIUTVFOTYMOJ-UHFFFAOYSA-M |
| XLogP | 1.15 |
| TPSA | 55.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.21 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|