C15H18N2OS — CID 87019766
(2,3-dimethyl-1H-indol-7-yl)-thiomorpholin-4-ylmethanone (PubChem CID 87019766) has the molecular formula C15H18N2OS and a molecular weight of 274.39 g/mol. Its IUPAC name is (2,3-dimethyl-1H-indol-7-yl)-thiomorpholin-4-ylmethanone.
| Compound Name | (2,3-dimethyl-1H-indol-7-yl)-thiomorpholin-4-ylmethanone |
|---|---|
| PubChem CID | 87019766 |
| Molecular Formula | C15H18N2OS |
| Molecular Weight | 274.39 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | (2,3-dimethyl-1H-indol-7-yl)-thiomorpholin-4-ylmethanone |
| SMILES | Cc1[nH]c2c(C(=O)N3CCSCC3)cccc2c1C |
| InChI | InChI=1S/C15H18N2OS/c1-10-11(2)16-14-12(10)4-3-5-13(14)15(18)17-6-8-19-9-7-17/h3-5,16H,6-9H2,1-2H3 |
| InChIKey | KUQMYWUJSCEXFQ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.39 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|