C21H21N5O — CID 78852290
2-[4-(2,3-dimethyl-1H-indole-7-carbonyl)piperazin-1-yl]pyridine-3-carbonitrile (PubChem CID 78852290) has the molecular formula C21H21N5O and a molecular weight of 359.43 g/mol. Its IUPAC name is 2-[4-(2,3-dimethyl-1H-indole-7-carbonyl)piperazin-1-yl]pyridine-3-carbonitrile.
| Compound Name | 2-[4-(2,3-dimethyl-1H-indole-7-carbonyl)piperazin-1-yl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 78852290 |
| Molecular Formula | C21H21N5O |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | 2-[4-(2,3-dimethyl-1H-indole-7-carbonyl)piperazin-1-yl]pyridine-3-carbonitrile |
| SMILES | Cc1[nH]c2c(C(=O)N3CCN(c4ncccc4C#N)CC3)cccc2c1C |
| InChI | InChI=1S/C21H21N5O/c1-14-15(2)24-19-17(14)6-3-7-18(19)21(27)26-11-9-25(10-12-26)20-16(13-22)5-4-8-23-20/h3-8,24H,9-12H2,1-2H3 |
| InChIKey | PNRLGEIJJDFIQV-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|