C21H30N4O — CID 72848556
(2,3-dimethyl-1H-indol-7-yl)-[4-(2-pyrrolidin-1-ylethyl)piperazin-1-yl]methanone (PubChem CID 72848556) has the molecular formula C21H30N4O and a molecular weight of 354.50 g/mol. Its IUPAC name is (2,3-dimethyl-1H-indol-7-yl)-[4-(2-pyrrolidin-1-ylethyl)piperazin-1-yl]methanone.
| Compound Name | (2,3-dimethyl-1H-indol-7-yl)-[4-(2-pyrrolidin-1-ylethyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 72848556 |
| Molecular Formula | C21H30N4O |
| Molecular Weight | 354.50 g/mol |
| Exact Mass | 354.24 |
| IUPAC Name | (2,3-dimethyl-1H-indol-7-yl)-[4-(2-pyrrolidin-1-ylethyl)piperazin-1-yl]methanone |
| SMILES | Cc1[nH]c2c(C(=O)N3CCN(CCN4CCCC4)CC3)cccc2c1C |
| InChI | InChI=1S/C21H30N4O/c1-16-17(2)22-20-18(16)6-5-7-19(20)21(26)25-14-12-24(13-15-25)11-10-23-8-3-4-9-23/h5-7,22H,3-4,8-15H2,1-2H3 |
| InChIKey | PLJDQRXTMWZLRE-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 42.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.50 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|