C23H29N3OS — CID 22017548
(2,3-dimethyl-1H-indol-7-yl)-[4-(3-thiophen-2-ylbutan-2-yl)piperazin-1-yl]methanone (PubChem CID 22017548) has the molecular formula C23H29N3OS and a molecular weight of 395.57 g/mol. Its IUPAC name is (2,3-dimethyl-1H-indol-7-yl)-[4-(3-thiophen-2-ylbutan-2-yl)piperazin-1-yl]methanone.
| Compound Name | (2,3-dimethyl-1H-indol-7-yl)-[4-(3-thiophen-2-ylbutan-2-yl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 22017548 |
| Molecular Formula | C23H29N3OS |
| Molecular Weight | 395.57 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | (2,3-dimethyl-1H-indol-7-yl)-[4-(3-thiophen-2-ylbutan-2-yl)piperazin-1-yl]methanone |
| SMILES | Cc1[nH]c2c(C(=O)N3CCN(C(C)C(C)c4cccs4)CC3)cccc2c1C |
| InChI | InChI=1S/C23H29N3OS/c1-15-17(3)24-22-19(15)7-5-8-20(22)23(27)26-12-10-25(11-13-26)18(4)16(2)21-9-6-14-28-21/h5-9,14,16,18,24H,10-13H2,1-4H3 |
| InChIKey | RATMLJZIFZPFOI-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 39.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.57 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|