C22H23N5O — CID 31999452
(2,3-dimethyl-1H-indol-7-yl)-[4-([1,2,4]triazolo[4,3-a]pyridin-3-yl)piperidin-1-yl]methanone (PubChem CID 31999452) has the molecular formula C22H23N5O and a molecular weight of 373.46 g/mol. Its IUPAC name is (2,3-dimethyl-1H-indol-7-yl)-[4-([1,2,4]triazolo[4,3-a]pyridin-3-yl)piperidin-1-yl]methanone.
| Compound Name | (2,3-dimethyl-1H-indol-7-yl)-[4-([1,2,4]triazolo[4,3-a]pyridin-3-yl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 31999452 |
| Molecular Formula | C22H23N5O |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | (2,3-dimethyl-1H-indol-7-yl)-[4-([1,2,4]triazolo[4,3-a]pyridin-3-yl)piperidin-1-yl]methanone |
| SMILES | Cc1[nH]c2c(C(=O)N3CCC(c4nnc5ccccn45)CC3)cccc2c1C |
| InChI | InChI=1S/C22H23N5O/c1-14-15(2)23-20-17(14)6-5-7-18(20)22(28)26-12-9-16(10-13-26)21-25-24-19-8-3-4-11-27(19)21/h3-8,11,16,23H,9-10,12-13H2,1-2H3 |
| InChIKey | TXMKBRKALSILQD-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|