C18H20N2OS — CID 42461714
2,3-dimethyl-N-[(2S)-1-thiophen-2-ylpropan-2-yl]-1H-indole-7-carboxamide (PubChem CID 42461714) has the molecular formula C18H20N2OS and a molecular weight of 312.44 g/mol. Its IUPAC name is 2,3-dimethyl-N-[(2S)-1-thiophen-2-ylpropan-2-yl]-1H-indole-7-carboxamide.
| Compound Name | 2,3-dimethyl-N-[(2S)-1-thiophen-2-ylpropan-2-yl]-1H-indole-7-carboxamide |
|---|---|
| PubChem CID | 42461714 |
| Molecular Formula | C18H20N2OS |
| Molecular Weight | 312.44 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | 2,3-dimethyl-N-[(2S)-1-thiophen-2-ylpropan-2-yl]-1H-indole-7-carboxamide |
| SMILES | Cc1[nH]c2c(C(=O)N[C@@H](C)Cc3cccs3)cccc2c1C |
| InChI | InChI=1S/C18H20N2OS/c1-11(10-14-6-5-9-22-14)19-18(21)16-8-4-7-15-12(2)13(3)20-17(15)16/h4-9,11,20H,10H2,1-3H3,(H,19,21)/t11-/m0/s1 |
| InChIKey | RDXWWTZKUDLNHA-NSHDSACASA-N |
| XLogP | 4.21 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.44 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|