C23H21N3O — CID 92604302
2,3-dimethyl-N-[(R)-phenyl(pyridin-4-yl)methyl]-1H-indole-7-carboxamide (PubChem CID 92604302) has the molecular formula C23H21N3O and a molecular weight of 355.44 g/mol. Its IUPAC name is 2,3-dimethyl-N-[(R)-phenyl(pyridin-4-yl)methyl]-1H-indole-7-carboxamide.
| Compound Name | 2,3-dimethyl-N-[(R)-phenyl(pyridin-4-yl)methyl]-1H-indole-7-carboxamide |
|---|---|
| PubChem CID | 92604302 |
| Molecular Formula | C23H21N3O |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.17 |
| IUPAC Name | 2,3-dimethyl-N-[(R)-phenyl(pyridin-4-yl)methyl]-1H-indole-7-carboxamide |
| SMILES | Cc1[nH]c2c(C(=O)N[C@H](c3ccccc3)c3ccncc3)cccc2c1C |
| InChI | InChI=1S/C23H21N3O/c1-15-16(2)25-22-19(15)9-6-10-20(22)23(27)26-21(17-7-4-3-5-8-17)18-11-13-24-14-12-18/h3-14,21,25H,1-2H3,(H,26,27)/t21-/m1/s1 |
| InChIKey | UDNVNEJSBWDWFE-OAQYLSRUSA-N |
| XLogP | 4.70 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|