C16H18N4O — CID 86979107
2,3-dimethyl-N-[(2-methylpyrazol-3-yl)methyl]-1H-indole-7-carboxamide (PubChem CID 86979107) has the molecular formula C16H18N4O and a molecular weight of 282.35 g/mol. Its IUPAC name is 2,3-dimethyl-N-[(2-methylpyrazol-3-yl)methyl]-1H-indole-7-carboxamide.
| Compound Name | 2,3-dimethyl-N-[(2-methylpyrazol-3-yl)methyl]-1H-indole-7-carboxamide |
|---|---|
| PubChem CID | 86979107 |
| Molecular Formula | C16H18N4O |
| Molecular Weight | 282.35 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | 2,3-dimethyl-N-[(2-methylpyrazol-3-yl)methyl]-1H-indole-7-carboxamide |
| SMILES | Cc1[nH]c2c(C(=O)NCc3ccnn3C)cccc2c1C |
| InChI | InChI=1S/C16H18N4O/c1-10-11(2)19-15-13(10)5-4-6-14(15)16(21)17-9-12-7-8-18-20(12)3/h4-8,19H,9H2,1-3H3,(H,17,21) |
| InChIKey | ACLGDEDQJYSTGP-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 62.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.35 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|