C19H18F2N2O2 — CID 111451352
N-[2-(2,6-difluorophenyl)-2-hydroxyethyl]-2,3-dimethyl-1H-indole-7-carboxamide (PubChem CID 111451352) has the molecular formula C19H18F2N2O2 and a molecular weight of 344.36 g/mol. Its IUPAC name is N-[2-(2,6-difluorophenyl)-2-hydroxyethyl]-2,3-dimethyl-1H-indole-7-carboxamide.
| Compound Name | N-[2-(2,6-difluorophenyl)-2-hydroxyethyl]-2,3-dimethyl-1H-indole-7-carboxamide |
|---|---|
| PubChem CID | 111451352 |
| Molecular Formula | C19H18F2N2O2 |
| Molecular Weight | 344.36 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | N-[2-(2,6-difluorophenyl)-2-hydroxyethyl]-2,3-dimethyl-1H-indole-7-carboxamide |
| SMILES | Cc1[nH]c2c(C(=O)NCC(O)c3c(F)cccc3F)cccc2c1C |
| InChI | InChI=1S/C19H18F2N2O2/c1-10-11(2)23-18-12(10)5-3-6-13(18)19(25)22-9-16(24)17-14(20)7-4-8-15(17)21/h3-8,16,23-24H,9H2,1-2H3,(H,22,25) |
| InChIKey | VMRFKPVYPMPFFD-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.36 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|