C18H26N2O2 — CID 30853286
N-(3-butoxypropyl)-2,3-dimethyl-1H-indole-7-carboxamide (PubChem CID 30853286) has the molecular formula C18H26N2O2 and a molecular weight of 302.42 g/mol. Its IUPAC name is N-(3-butoxypropyl)-2,3-dimethyl-1H-indole-7-carboxamide.
| Compound Name | N-(3-butoxypropyl)-2,3-dimethyl-1H-indole-7-carboxamide |
|---|---|
| PubChem CID | 30853286 |
| Molecular Formula | C18H26N2O2 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.20 |
| IUPAC Name | N-(3-butoxypropyl)-2,3-dimethyl-1H-indole-7-carboxamide |
| SMILES | CCCCOCCCNC(=O)c1cccc2c(C)c(C)[nH]c12 |
| InChI | InChI=1S/C18H26N2O2/c1-4-5-11-22-12-7-10-19-18(21)16-9-6-8-15-13(2)14(3)20-17(15)16/h6,8-9,20H,4-5,7,10-12H2,1-3H3,(H,19,21) |
| InChIKey | VYGQMQNLHUYEMB-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|