C13H19NO5 — CID 104936500
2,3-dihydroxy-N-[3-(2-methoxyethoxy)propyl]benzamide (PubChem CID 104936500) has the molecular formula C13H19NO5 and a molecular weight of 269.30 g/mol. Its IUPAC name is 2,3-dihydroxy-N-[3-(2-methoxyethoxy)propyl]benzamide.
| Compound Name | 2,3-dihydroxy-N-[3-(2-methoxyethoxy)propyl]benzamide |
|---|---|
| PubChem CID | 104936500 |
| Molecular Formula | C13H19NO5 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | 2,3-dihydroxy-N-[3-(2-methoxyethoxy)propyl]benzamide |
| SMILES | COCCOCCCNC(=O)c1cccc(O)c1O |
| InChI | InChI=1S/C13H19NO5/c1-18-8-9-19-7-3-6-14-13(17)10-4-2-5-11(15)12(10)16/h2,4-5,15-16H,3,6-9H2,1H3,(H,14,17) |
| InChIKey | JXPCFAOENTXQFX-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|