C12H16BrNO3 — CID 106307317
N-[3-(2-bromoethoxy)propyl]-2-hydroxybenzamide (PubChem CID 106307317) has the molecular formula C12H16BrNO3 and a molecular weight of 302.17 g/mol. Its IUPAC name is N-[3-(2-bromoethoxy)propyl]-2-hydroxybenzamide.
| Compound Name | N-[3-(2-bromoethoxy)propyl]-2-hydroxybenzamide |
|---|---|
| PubChem CID | 106307317 |
| Molecular Formula | C12H16BrNO3 |
| Molecular Weight | 302.17 g/mol |
| Exact Mass | 301.03 |
| IUPAC Name | N-[3-(2-bromoethoxy)propyl]-2-hydroxybenzamide |
| SMILES | O=C(NCCCOCCBr)c1ccccc1O |
| InChI | InChI=1S/C12H16BrNO3/c13-6-9-17-8-3-7-14-12(16)10-4-1-2-5-11(10)15/h1-2,4-5,15H,3,6-9H2,(H,14,16) |
| InChIKey | RWQHTNGLJLNJTP-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.17 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|