C12H18N2O4 — CID 114171525
N-[3-(2-aminoethoxy)propyl]-2,3-dihydroxybenzamide (PubChem CID 114171525) has the molecular formula C12H18N2O4 and a molecular weight of 254.29 g/mol. Its IUPAC name is N-[3-(2-aminoethoxy)propyl]-2,3-dihydroxybenzamide.
| Compound Name | N-[3-(2-aminoethoxy)propyl]-2,3-dihydroxybenzamide |
|---|---|
| PubChem CID | 114171525 |
| Molecular Formula | C12H18N2O4 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | N-[3-(2-aminoethoxy)propyl]-2,3-dihydroxybenzamide |
| SMILES | NCCOCCCNC(=O)c1cccc(O)c1O |
| InChI | InChI=1S/C12H18N2O4/c13-5-8-18-7-2-6-14-12(17)9-3-1-4-10(15)11(9)16/h1,3-4,15-16H,2,5-8,13H2,(H,14,17) |
| InChIKey | MDTISEDCJDVBMU-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|