C14H18N2O3 — CID 106307933
N-[3-(2-aminoethoxy)propyl]-1-benzofuran-3-carboxamide (PubChem CID 106307933) has the molecular formula C14H18N2O3 and a molecular weight of 262.31 g/mol. Its IUPAC name is N-[3-(2-aminoethoxy)propyl]-1-benzofuran-3-carboxamide.
| Compound Name | N-[3-(2-aminoethoxy)propyl]-1-benzofuran-3-carboxamide |
|---|---|
| PubChem CID | 106307933 |
| Molecular Formula | C14H18N2O3 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | N-[3-(2-aminoethoxy)propyl]-1-benzofuran-3-carboxamide |
| SMILES | NCCOCCCNC(=O)c1coc2ccccc12 |
| InChI | InChI=1S/C14H18N2O3/c15-6-9-18-8-3-7-16-14(17)12-10-19-13-5-2-1-4-11(12)13/h1-2,4-5,10H,3,6-9,15H2,(H,16,17) |
| InChIKey | MGHBYBWJUFLJQP-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 77.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|