C10H16N2O3 — CID 106307825
N-[3-(2-aminoethoxy)propyl]furan-3-carboxamide (PubChem CID 106307825) has the molecular formula C10H16N2O3 and a molecular weight of 212.25 g/mol. Its IUPAC name is N-[3-(2-aminoethoxy)propyl]furan-3-carboxamide.
| Compound Name | N-[3-(2-aminoethoxy)propyl]furan-3-carboxamide |
|---|---|
| PubChem CID | 106307825 |
| Molecular Formula | C10H16N2O3 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | N-[3-(2-aminoethoxy)propyl]furan-3-carboxamide |
| SMILES | NCCOCCCNC(=O)c1ccoc1 |
| InChI | InChI=1S/C10H16N2O3/c11-3-7-14-5-1-4-12-10(13)9-2-6-15-8-9/h2,6,8H,1,3-5,7,11H2,(H,12,13) |
| InChIKey | FKVMDYXXNWOLCK-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 77.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|