C12H13F5N2O2 — CID 106307985
N-[3-(2-aminoethoxy)propyl]-2,3,4,5,6-pentafluorobenzamide (PubChem CID 106307985) has the molecular formula C12H13F5N2O2 and a molecular weight of 312.24 g/mol. Its IUPAC name is N-[3-(2-aminoethoxy)propyl]-2,3,4,5,6-pentafluorobenzamide.
| Compound Name | N-[3-(2-aminoethoxy)propyl]-2,3,4,5,6-pentafluorobenzamide |
|---|---|
| PubChem CID | 106307985 |
| Molecular Formula | C12H13F5N2O2 |
| Molecular Weight | 312.24 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | N-[3-(2-aminoethoxy)propyl]-2,3,4,5,6-pentafluorobenzamide |
| SMILES | NCCOCCCNC(=O)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C12H13F5N2O2/c13-7-6(8(14)10(16)11(17)9(7)15)12(20)19-3-1-4-21-5-2-18/h1-5,18H2,(H,19,20) |
| InChIKey | CEDWLXMKBZERBS-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.24 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|