C12H13F5N2O — CID 4207479
N-[3-(dimethylamino)propyl]-2,3,4,5,6-pentafluorobenzamide (PubChem CID 4207479) has the molecular formula C12H13F5N2O and a molecular weight of 296.24 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-2,3,4,5,6-pentafluorobenzamide.
| Compound Name | N-[3-(dimethylamino)propyl]-2,3,4,5,6-pentafluorobenzamide |
|---|---|
| PubChem CID | 4207479 |
| Molecular Formula | C12H13F5N2O |
| Molecular Weight | 296.24 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-2,3,4,5,6-pentafluorobenzamide |
| SMILES | CN(C)CCCNC(=O)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C12H13F5N2O/c1-19(2)5-3-4-18-12(20)6-7(13)9(15)11(17)10(16)8(6)14/h3-5H2,1-2H3,(H,18,20) |
| InChIKey | WTXYFHPWIISPQJ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.24 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|