C11H14F2N2O — CID 17249262
N-[2-(dimethylamino)ethyl]-2,6-difluorobenzamide (PubChem CID 17249262) has the molecular formula C11H14F2N2O and a molecular weight of 228.24 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-2,6-difluorobenzamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-2,6-difluorobenzamide |
|---|---|
| PubChem CID | 17249262 |
| Molecular Formula | C11H14F2N2O |
| Molecular Weight | 228.24 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-2,6-difluorobenzamide |
| SMILES | CN(C)CCNC(=O)c1c(F)cccc1F |
| InChI | InChI=1S/C11H14F2N2O/c1-15(2)7-6-14-11(16)10-8(12)4-3-5-9(10)13/h3-5H,6-7H2,1-2H3,(H,14,16) |
| InChIKey | CDLGDENQXKROMZ-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.24 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |