C11H13BrF2N2O — CID 172646665
4-bromo-N-[2-(dimethylamino)ethyl]-3,5-difluorobenzamide (PubChem CID 172646665) has the molecular formula C11H13BrF2N2O and a molecular weight of 307.14 g/mol. Its IUPAC name is 4-bromo-N-[2-(dimethylamino)ethyl]-3,5-difluorobenzamide.
| Compound Name | 4-bromo-N-[2-(dimethylamino)ethyl]-3,5-difluorobenzamide |
|---|---|
| PubChem CID | 172646665 |
| Molecular Formula | C11H13BrF2N2O |
| Molecular Weight | 307.14 g/mol |
| Exact Mass | 306.02 |
| IUPAC Name | 4-bromo-N-[2-(dimethylamino)ethyl]-3,5-difluorobenzamide |
| SMILES | CN(C)CCNC(=O)c1cc(F)c(Br)c(F)c1 |
| InChI | InChI=1S/C11H13BrF2N2O/c1-16(2)4-3-15-11(17)7-5-8(13)10(12)9(14)6-7/h5-6H,3-4H2,1-2H3,(H,15,17) |
| InChIKey | TXHPGIDPTPPYQO-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.14 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|