C17H28N2O4 — CID 756601
N-[2-(dimethylamino)ethyl]-3,4,5-triethoxybenzamide (PubChem CID 756601) has the molecular formula C17H28N2O4 and a molecular weight of 324.42 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-3,4,5-triethoxybenzamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-3,4,5-triethoxybenzamide |
|---|---|
| PubChem CID | 756601 |
| Molecular Formula | C17H28N2O4 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.20 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-3,4,5-triethoxybenzamide |
| SMILES | CCOc1cc(C(=O)NCCN(C)C)cc(OCC)c1OCC |
| InChI | InChI=1S/C17H28N2O4/c1-6-21-14-11-13(17(20)18-9-10-19(4)5)12-15(22-7-2)16(14)23-8-3/h11-12H,6-10H2,1-5H3,(H,18,20) |
| InChIKey | RBZPFHODVKADAQ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |