C33H36N2O4 — CID 3289624
N-[3-(dimethylamino)propyl]-3,4,5-tris(phenylmethoxy)benzamide (PubChem CID 3289624) has the molecular formula C33H36N2O4 and a molecular weight of 524.66 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-3,4,5-tris(phenylmethoxy)benzamide.
| Compound Name | N-[3-(dimethylamino)propyl]-3,4,5-tris(phenylmethoxy)benzamide |
|---|---|
| PubChem CID | 3289624 |
| Molecular Formula | C33H36N2O4 |
| Molecular Weight | 524.66 g/mol |
| Exact Mass | 524.27 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-3,4,5-tris(phenylmethoxy)benzamide |
| SMILES | CN(C)CCCNC(=O)c1cc(OCc2ccccc2)c(OCc2ccccc2)c(OCc2ccccc2)c1 |
| InChI | InChI=1S/C33H36N2O4/c1-35(2)20-12-19-34-33(36)29-21-30(37-23-26-13-6-3-7-14-26)32(39-25-28-17-10-5-11-18-28)31(22-29)38-24-27-15-8-4-9-16-27/h3-11,13-18,21-22H,12,19-20,23-25H2,1-2H3,(H,34,36) |
| InChIKey | WUEOPVXVTZUNKI-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.66 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|