C43H44N2O7 — CID 99648353
methyl (2R)-6-[(2-phenylacetyl)amino]-2-[[3,4,5-tris(phenylmethoxy)benzoyl]amino]hexanoate (PubChem CID 99648353) has the molecular formula C43H44N2O7 and a molecular weight of 700.83 g/mol. Its IUPAC name is methyl (2R)-6-[(2-phenylacetyl)amino]-2-[[3,4,5-tris(phenylmethoxy)benzoyl]amino]hexanoate.
| Compound Name | methyl (2R)-6-[(2-phenylacetyl)amino]-2-[[3,4,5-tris(phenylmethoxy)benzoyl]amino]hexanoate |
|---|---|
| PubChem CID | 99648353 |
| Molecular Formula | C43H44N2O7 |
| Molecular Weight | 700.83 g/mol |
| Exact Mass | 700.31 |
| IUPAC Name | methyl (2R)-6-[(2-phenylacetyl)amino]-2-[[3,4,5-tris(phenylmethoxy)benzoyl]amino]hexanoate |
| SMILES | COC(=O)[C@@H](CCCCNC(=O)Cc1ccccc1)NC(=O)c1cc(OCc2ccccc2)c(OCc2ccccc2)c(OCc2ccccc2)c1 |
| InChI | InChI=1S/C43H44N2O7/c1-49-43(48)37(24-14-15-25-44-40(46)26-32-16-6-2-7-17-32)45-42(47)36-27-38(50-29-33-18-8-3-9-19-33)41(52-31-35-22-12-5-13-23-35)39(28-36)51-30-34-20-10-4-11-21-34/h2-13,16-23,27-28,37H,14-15,24-26,29-31H2,1H3,(H,44,46)(H,45,47)/t37-/m1/s1 |
| InChIKey | KEEGCMXPFBWJKO-DIPNUNPCSA-N |
| XLogP | 7.22 |
| TPSA | 112.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.83 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|