C48H53N3O10 — CID 99695137
ethyl (2R,3R)-3-hydroxy-2-[[(2S)-6-(phenylmethoxycarbonylamino)-2-[[3,4,5-tris(phenylmethoxy)benzoyl]amino]hexanoyl]amino]butanoate (PubChem CID 99695137) has the molecular formula C48H53N3O10 and a molecular weight of 831.96 g/mol. Its IUPAC name is ethyl (2R,3R)-3-hydroxy-2-[[(2S)-6-(phenylmethoxycarbonylamino)-2-[[3,4,5-tris(phenylmethoxy)benzoyl]amino]hexanoyl]amino]butanoate.
| Compound Name | ethyl (2R,3R)-3-hydroxy-2-[[(2S)-6-(phenylmethoxycarbonylamino)-2-[[3,4,5-tris(phenylmethoxy)benzoyl]amino]hexanoyl]amino]butanoate |
|---|---|
| PubChem CID | 99695137 |
| Molecular Formula | C48H53N3O10 |
| Molecular Weight | 831.96 g/mol |
| Exact Mass | 831.37 |
| IUPAC Name | ethyl (2R,3R)-3-hydroxy-2-[[(2S)-6-(phenylmethoxycarbonylamino)-2-[[3,4,5-tris(phenylmethoxy)benzoyl]amino]hexanoyl]amino]butanoate |
| SMILES | CCOC(=O)[C@H](NC(=O)[C@H](CCCCNC(=O)OCc1ccccc1)NC(=O)c1cc(OCc2ccccc2)c(OCc2ccccc2)c(OCc2ccccc2)c1)[C@@H](C)O |
| InChI | InChI=1S/C48H53N3O10/c1-3-57-47(55)43(34(2)52)51-46(54)40(26-16-17-27-49-48(56)61-33-38-24-14-7-15-25-38)50-45(53)39-28-41(58-30-35-18-8-4-9-19-35)44(60-32-37-22-12-6-13-23-37)42(29-39)59-31-36-20-10-5-11-21-36/h4-15,18-25,28-29,34,40,43,52H,3,16-17,26-27,30-33H2,1-2H3,(H,49,56)(H,50,53)(H,51,54)/t34-,40+,43-/m1/s1 |
| InChIKey | YICNUPSLZMEGEF-ZLLWNTCCSA-N |
| XLogP | 7.05 |
| TPSA | 170.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 831.96 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|