C16H23NO5 — CID 21392364
ethyl 2-hydroxy-6-(phenylmethoxycarbonylamino)hexanoate (PubChem CID 21392364) has the molecular formula C16H23NO5 and a molecular weight of 309.36 g/mol. Its IUPAC name is ethyl 2-hydroxy-6-(phenylmethoxycarbonylamino)hexanoate.
| Compound Name | ethyl 2-hydroxy-6-(phenylmethoxycarbonylamino)hexanoate |
|---|---|
| PubChem CID | 21392364 |
| Molecular Formula | C16H23NO5 |
| Molecular Weight | 309.36 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | ethyl 2-hydroxy-6-(phenylmethoxycarbonylamino)hexanoate |
| SMILES | CCOC(=O)C(O)CCCCNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C16H23NO5/c1-2-21-15(19)14(18)10-6-7-11-17-16(20)22-12-13-8-4-3-5-9-13/h3-5,8-9,14,18H,2,6-7,10-12H2,1H3,(H,17,20) |
| InChIKey | CNMJWWOYQBTYEA-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.36 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|