C18H29NO4 — CID 158989140
(2R)-2-methyl-6-(phenylmethoxycarbonylamino)hexanoic acid;propane (PubChem CID 158989140) has the molecular formula C18H29NO4 and a molecular weight of 323.43 g/mol. Its IUPAC name is (2R)-2-methyl-6-(phenylmethoxycarbonylamino)hexanoic acid;propane.
| Compound Name | (2R)-2-methyl-6-(phenylmethoxycarbonylamino)hexanoic acid;propane |
|---|---|
| PubChem CID | 158989140 |
| Molecular Formula | C18H29NO4 |
| Molecular Weight | 323.43 g/mol |
| Exact Mass | 323.21 |
| IUPAC Name | (2R)-2-methyl-6-(phenylmethoxycarbonylamino)hexanoic acid;propane |
| SMILES | CCC.C[C@H](CCCCNC(=O)OCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C15H21NO4.C3H8/c1-12(14(17)18)7-5-6-10-16-15(19)20-11-13-8-3-2-4-9-13;1-3-2/h2-4,8-9,12H,5-7,10-11H2,1H3,(H,16,19)(H,17,18);3H2,1-2H3/t12-;/m1./s1 |
| InChIKey | JPYIBSWIQQBXII-UTONKHPSSA-N |
| XLogP | 4.22 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.43 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|