C28H40CuN4O8 — CID 10579765
bis(2-amino-6-(phenylmethoxycarbonylamino)hexanoic acid);copper (PubChem CID 10579765) has the molecular formula C28H40CuN4O8 and a molecular weight of 624.19 g/mol. Its IUPAC name is bis(2-amino-6-(phenylmethoxycarbonylamino)hexanoic acid);copper.
| Compound Name | bis(2-amino-6-(phenylmethoxycarbonylamino)hexanoic acid);copper |
|---|---|
| PubChem CID | 10579765 |
| Molecular Formula | C28H40CuN4O8 |
| Molecular Weight | 624.19 g/mol |
| Exact Mass | 623.21 |
| IUPAC Name | bis(2-amino-6-(phenylmethoxycarbonylamino)hexanoic acid);copper |
| SMILES | NC(CCCCNC(=O)OCc1ccccc1)C(=O)O.NC(CCCCNC(=O)OCc1ccccc1)C(=O)O.[Cu] |
| InChI | InChI=1S/2C14H20N2O4.Cu/c2*15-12(13(17)18)8-4-5-9-16-14(19)20-10-11-6-2-1-3-7-11;/h2*1-3,6-7,12H,4-5,8-10,15H2,(H,16,19)(H,17,18); |
| InChIKey | XTTPWMHBRXCZJS-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 203.30 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.19 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|