C28H33N3O3 — CID 70053554
benzyl N-[(5S)-5-amino-6-(2,2-diphenylethylamino)-6-oxohexyl]carbamate (PubChem CID 70053554) has the molecular formula C28H33N3O3 and a molecular weight of 459.59 g/mol. Its IUPAC name is benzyl N-[(5S)-5-amino-6-(2,2-diphenylethylamino)-6-oxohexyl]carbamate.
| Compound Name | benzyl N-[(5S)-5-amino-6-(2,2-diphenylethylamino)-6-oxohexyl]carbamate |
|---|---|
| PubChem CID | 70053554 |
| Molecular Formula | C28H33N3O3 |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 459.25 |
| IUPAC Name | benzyl N-[(5S)-5-amino-6-(2,2-diphenylethylamino)-6-oxohexyl]carbamate |
| SMILES | N[C@@H](CCCCNC(=O)OCc1ccccc1)C(=O)NCC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H33N3O3/c29-26(18-10-11-19-30-28(33)34-21-22-12-4-1-5-13-22)27(32)31-20-25(23-14-6-2-7-15-23)24-16-8-3-9-17-24/h1-9,12-17,25-26H,10-11,18-21,29H2,(H,30,33)(H,31,32)/t26-/m0/s1 |
| InChIKey | OWHXNNCUGKSWLH-SANMLTNESA-N |
| XLogP | 4.36 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|