C21H27N3O2 — CID 145294466
2-amino-N-(2,2-diphenylethyl)-6-formamidohexanamide (PubChem CID 145294466) has the molecular formula C21H27N3O2 and a molecular weight of 353.47 g/mol. Its IUPAC name is 2-amino-N-(2,2-diphenylethyl)-6-formamidohexanamide.
| Compound Name | 2-amino-N-(2,2-diphenylethyl)-6-formamidohexanamide |
|---|---|
| PubChem CID | 145294466 |
| Molecular Formula | C21H27N3O2 |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.21 |
| IUPAC Name | 2-amino-N-(2,2-diphenylethyl)-6-formamidohexanamide |
| SMILES | NC(CCCCNC=O)C(=O)NCC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H27N3O2/c22-20(13-7-8-14-23-16-25)21(26)24-15-19(17-9-3-1-4-10-17)18-11-5-2-6-12-18/h1-6,9-12,16,19-20H,7-8,13-15,22H2,(H,23,25)(H,24,26) |
| InChIKey | DNEREXRQLFJNGR-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|