C42H56N6S2 — CID 54757511
1-(2,2-diphenylethyl)-3-[3-[6-[3-(2,2-diphenylethylcarbamothioylamino)propylamino]hexylamino]propyl]thiourea (PubChem CID 54757511) has the molecular formula C42H56N6S2 and a molecular weight of 709.09 g/mol. Its IUPAC name is 1-(2,2-diphenylethyl)-3-[3-[6-[3-(2,2-diphenylethylcarbamothioylamino)propylamino]hexylamino]propyl]thiourea.
| Compound Name | 1-(2,2-diphenylethyl)-3-[3-[6-[3-(2,2-diphenylethylcarbamothioylamino)propylamino]hexylamino]propyl]thiourea |
|---|---|
| PubChem CID | 54757511 |
| Molecular Formula | C42H56N6S2 |
| Molecular Weight | 709.09 g/mol |
| Exact Mass | 708.40 |
| IUPAC Name | 1-(2,2-diphenylethyl)-3-[3-[6-[3-(2,2-diphenylethylcarbamothioylamino)propylamino]hexylamino]propyl]thiourea |
| SMILES | S=C(NCCCNCCCCCCNCCCNC(=S)NCC(c1ccccc1)c1ccccc1)NCC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C42H56N6S2/c49-41(47-33-39(35-19-7-3-8-20-35)36-21-9-4-10-22-36)45-31-17-29-43-27-15-1-2-16-28-44-30-18-32-46-42(50)48-34-40(37-23-11-5-12-24-37)38-25-13-6-14-26-38/h3-14,19-26,39-40,43-44H,1-2,15-18,27-34H2,(H2,45,47,49)(H2,46,48,50) |
| InChIKey | VTZOOSXTGGHSOH-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 72.18 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.09 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|