potassium N-(2,2-diphenylethyl)carbamodithioate

C15H14KNS2 — CID 118002366

IUPACpotassium N-(2,2-diphenylethyl)carbamodithioate
SMILESS=C([S-])NCC(c1ccccc1)c1ccccc1.[K+]
InChIInChI=1S/C15H15NS2.K/c17-15(18)16-11-14(12-7-3-1-4-8-12)13-9-5-2-6-10-13;/h1-10,14H,11H2,(H2,16,17,18);/q;+1/p-1
InChIKeyLGACKRNVRKGBGT-UHFFFAOYSA-M
MW311.52 g/mol
LogP0.24
Rot. Bonds4

About potassium N-(2,2-diphenylethyl)carbamodithioate

potassium N-(2,2-diphenylethyl)carbamodithioate (PubChem CID 118002366) has the molecular formula C15H14KNS2 and a molecular weight of 311.52 g/mol. Its IUPAC name is potassium N-(2,2-diphenylethyl)carbamodithioate.

Molecular Properties

Compound Namepotassium N-(2,2-diphenylethyl)carbamodithioate
PubChem CID118002366
Molecular FormulaC15H14KNS2
Molecular Weight311.52 g/mol
Exact Mass311.02
IUPAC Namepotassium N-(2,2-diphenylethyl)carbamodithioate
SMILESS=C([S-])NCC(c1ccccc1)c1ccccc1.[K+]
InChIInChI=1S/C15H15NS2.K/c17-15(18)16-11-14(12-7-3-1-4-8-12)13-9-5-2-6-10-13;/h1-10,14H,11H2,(H2,16,17,18);/q;+1/p-1
InChIKeyLGACKRNVRKGBGT-UHFFFAOYSA-M
XLogP0.24
TPSA12.03 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500311.52
LogP ≤ 50.24
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'}

Analyze potassium N-(2,2-diphenylethyl)carbamodithioate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of potassium N-(2,2-diphenylethyl)carbamodithioate?
The IUPAC name of potassium N-(2,2-diphenylethyl)carbamodithioate (CID 118002366) is potassium N-(2,2-diphenylethyl)carbamodithioate.
What is the SMILES notation for potassium N-(2,2-diphenylethyl)carbamodithioate?
The canonical SMILES for potassium N-(2,2-diphenylethyl)carbamodithioate is S=C([S-])NCC(c1ccccc1)c1ccccc1.[K+].
What is the InChIKey of potassium N-(2,2-diphenylethyl)carbamodithioate?
The InChIKey is LGACKRNVRKGBGT-UHFFFAOYSA-M. The full InChI is InChI=1S/C15H15NS2.K/c17-15(18)16-11-14(12-7-3-1-4-8-12)13-9-5-2-6-10-13;/h1-10,14H,11H2,(H2,16,17,18);/q;+1/p-1.
What are the key properties of potassium N-(2,2-diphenylethyl)carbamodithioate?
potassium N-(2,2-diphenylethyl)carbamodithioate has a molecular weight of 311.52 g/mol, XLogP of 0.24, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for potassium N-(2,2-diphenylethyl)carbamodithioate is sourced from PubChem (CID 118002366), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).