C15H14KNS2 — CID 118002366
potassium N-(2,2-diphenylethyl)carbamodithioate (PubChem CID 118002366) has the molecular formula C15H14KNS2 and a molecular weight of 311.52 g/mol. Its IUPAC name is potassium N-(2,2-diphenylethyl)carbamodithioate.
| Compound Name | potassium N-(2,2-diphenylethyl)carbamodithioate |
|---|---|
| PubChem CID | 118002366 |
| Molecular Formula | C15H14KNS2 |
| Molecular Weight | 311.52 g/mol |
| Exact Mass | 311.02 |
| IUPAC Name | potassium N-(2,2-diphenylethyl)carbamodithioate |
| SMILES | S=C([S-])NCC(c1ccccc1)c1ccccc1.[K+] |
| InChI | InChI=1S/C15H15NS2.K/c17-15(18)16-11-14(12-7-3-1-4-8-12)13-9-5-2-6-10-13;/h1-10,14H,11H2,(H2,16,17,18);/q;+1/p-1 |
| InChIKey | LGACKRNVRKGBGT-UHFFFAOYSA-M |
| XLogP | 0.24 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.52 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|