C22H21NO2 — CID 78806805
N-(2,2-diphenylethyl)-2-(4-hydroxyphenyl)acetamide (PubChem CID 78806805) has the molecular formula C22H21NO2 and a molecular weight of 331.42 g/mol. Its IUPAC name is N-(2,2-diphenylethyl)-2-(4-hydroxyphenyl)acetamide.
| Compound Name | N-(2,2-diphenylethyl)-2-(4-hydroxyphenyl)acetamide |
|---|---|
| PubChem CID | 78806805 |
| Molecular Formula | C22H21NO2 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | N-(2,2-diphenylethyl)-2-(4-hydroxyphenyl)acetamide |
| SMILES | O=C(Cc1ccc(O)cc1)NCC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H21NO2/c24-20-13-11-17(12-14-20)15-22(25)23-16-21(18-7-3-1-4-8-18)19-9-5-2-6-10-19/h1-14,21,24H,15-16H2,(H,23,25) |
| InChIKey | CCFOCQVYLGDDCB-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |