C16H16ClNO2 — CID 114295749
N-(2-chloro-2-phenylethyl)-2-(3-hydroxyphenyl)acetamide (PubChem CID 114295749) has the molecular formula C16H16ClNO2 and a molecular weight of 289.76 g/mol. Its IUPAC name is N-(2-chloro-2-phenylethyl)-2-(3-hydroxyphenyl)acetamide.
| Compound Name | N-(2-chloro-2-phenylethyl)-2-(3-hydroxyphenyl)acetamide |
|---|---|
| PubChem CID | 114295749 |
| Molecular Formula | C16H16ClNO2 |
| Molecular Weight | 289.76 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | N-(2-chloro-2-phenylethyl)-2-(3-hydroxyphenyl)acetamide |
| SMILES | O=C(Cc1cccc(O)c1)NCC(Cl)c1ccccc1 |
| InChI | InChI=1S/C16H16ClNO2/c17-15(13-6-2-1-3-7-13)11-18-16(20)10-12-5-4-8-14(19)9-12/h1-9,15,19H,10-11H2,(H,18,20) |
| InChIKey | RPFXTGSVMSKTHC-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.76 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|