C41H56N6S2 — CID 158302343
1-(2,2-diphenylethyl)-3-[3-[4-[3-(2,2-diphenylethylcarbamothioylamino)propylamino]butylamino]propyl]thiourea;methane (PubChem CID 158302343) has the molecular formula C41H56N6S2 and a molecular weight of 697.08 g/mol. Its IUPAC name is 1-(2,2-diphenylethyl)-3-[3-[4-[3-(2,2-diphenylethylcarbamothioylamino)propylamino]butylamino]propyl]thiourea;methane.
| Compound Name | 1-(2,2-diphenylethyl)-3-[3-[4-[3-(2,2-diphenylethylcarbamothioylamino)propylamino]butylamino]propyl]thiourea;methane |
|---|---|
| PubChem CID | 158302343 |
| Molecular Formula | C41H56N6S2 |
| Molecular Weight | 697.08 g/mol |
| Exact Mass | 696.40 |
| IUPAC Name | 1-(2,2-diphenylethyl)-3-[3-[4-[3-(2,2-diphenylethylcarbamothioylamino)propylamino]butylamino]propyl]thiourea;methane |
| SMILES | C.S=C(NCCCNCCCCNCCCNC(=S)NCC(c1ccccc1)c1ccccc1)NCC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C40H52N6S2.CH4/c47-39(45-31-37(33-17-5-1-6-18-33)34-19-7-2-8-20-34)43-29-15-27-41-25-13-14-26-42-28-16-30-44-40(48)46-32-38(35-21-9-3-10-22-35)36-23-11-4-12-24-36;/h1-12,17-24,37-38,41-42H,13-16,25-32H2,(H2,43,45,47)(H2,44,46,48);1H4 |
| InChIKey | GMQMBZCIDABSDM-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 72.18 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.08 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|