C21H25N3S — CID 2108617
1-butyl-3-[(2R)-2-(1H-indol-3-yl)-2-phenylethyl]thiourea (PubChem CID 2108617) has the molecular formula C21H25N3S and a molecular weight of 351.52 g/mol. Its IUPAC name is 1-butyl-3-[(2R)-2-(1H-indol-3-yl)-2-phenylethyl]thiourea.
| Compound Name | 1-butyl-3-[(2R)-2-(1H-indol-3-yl)-2-phenylethyl]thiourea |
|---|---|
| PubChem CID | 2108617 |
| Molecular Formula | C21H25N3S |
| Molecular Weight | 351.52 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | 1-butyl-3-[(2R)-2-(1H-indol-3-yl)-2-phenylethyl]thiourea |
| SMILES | CCCCNC(=S)NC[C@H](c1ccccc1)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C21H25N3S/c1-2-3-13-22-21(25)24-14-18(16-9-5-4-6-10-16)19-15-23-20-12-8-7-11-17(19)20/h4-12,15,18,23H,2-3,13-14H2,1H3,(H2,22,24,25)/t18-/m1/s1 |
| InChIKey | VKDMQKVSBOCZIQ-GOSISDBHSA-N |
| XLogP | 4.56 |
| TPSA | 39.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.52 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|