C22H28N4S — CID 8660529
1-[(2S)-2-[4-(dimethylamino)phenyl]-2-(1H-indol-3-yl)ethyl]-3-propylthiourea (PubChem CID 8660529) has the molecular formula C22H28N4S and a molecular weight of 380.56 g/mol. Its IUPAC name is 1-[(2S)-2-[4-(dimethylamino)phenyl]-2-(1H-indol-3-yl)ethyl]-3-propylthiourea.
| Compound Name | 1-[(2S)-2-[4-(dimethylamino)phenyl]-2-(1H-indol-3-yl)ethyl]-3-propylthiourea |
|---|---|
| PubChem CID | 8660529 |
| Molecular Formula | C22H28N4S |
| Molecular Weight | 380.56 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | 1-[(2S)-2-[4-(dimethylamino)phenyl]-2-(1H-indol-3-yl)ethyl]-3-propylthiourea |
| SMILES | CCCNC(=S)NC[C@@H](c1ccc(N(C)C)cc1)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C22H28N4S/c1-4-13-23-22(27)25-14-19(16-9-11-17(12-10-16)26(2)3)20-15-24-21-8-6-5-7-18(20)21/h5-12,15,19,24H,4,13-14H2,1-3H3,(H2,23,25,27)/t19-/m0/s1 |
| InChIKey | SQPBGSCRLQJAMK-IBGZPJMESA-N |
| XLogP | 4.24 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.56 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|