C23H26N4S — CID 172695613
1-[2,2-bis(1H-indol-3-yl)ethyl]-3-butylthiourea (PubChem CID 172695613) has the molecular formula C23H26N4S and a molecular weight of 390.56 g/mol. Its IUPAC name is 1-[2,2-bis(1H-indol-3-yl)ethyl]-3-butylthiourea.
| Compound Name | 1-[2,2-bis(1H-indol-3-yl)ethyl]-3-butylthiourea |
|---|---|
| PubChem CID | 172695613 |
| Molecular Formula | C23H26N4S |
| Molecular Weight | 390.56 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | 1-[2,2-bis(1H-indol-3-yl)ethyl]-3-butylthiourea |
| SMILES | CCCCNC(=S)NCC(c1c[nH]c2ccccc12)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C23H26N4S/c1-2-3-12-24-23(28)27-15-20(18-13-25-21-10-6-4-8-16(18)21)19-14-26-22-11-7-5-9-17(19)22/h4-11,13-14,20,25-26H,2-3,12,15H2,1H3,(H2,24,27,28) |
| InChIKey | CGYHREBPUUSSFI-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 55.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.56 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|