C25H21FN4S — CID 172720447
1-[2,2-bis(1H-indol-3-yl)ethyl]-3-(4-fluorophenyl)thiourea (PubChem CID 172720447) has the molecular formula C25H21FN4S and a molecular weight of 428.54 g/mol. Its IUPAC name is 1-[2,2-bis(1H-indol-3-yl)ethyl]-3-(4-fluorophenyl)thiourea.
| Compound Name | 1-[2,2-bis(1H-indol-3-yl)ethyl]-3-(4-fluorophenyl)thiourea |
|---|---|
| PubChem CID | 172720447 |
| Molecular Formula | C25H21FN4S |
| Molecular Weight | 428.54 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | 1-[2,2-bis(1H-indol-3-yl)ethyl]-3-(4-fluorophenyl)thiourea |
| SMILES | Fc1ccc(NC(=S)NCC(c2c[nH]c3ccccc23)c2c[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C25H21FN4S/c26-16-9-11-17(12-10-16)30-25(31)29-15-22(20-13-27-23-7-3-1-5-18(20)23)21-14-28-24-8-4-2-6-19(21)24/h1-14,22,27-28H,15H2,(H2,29,30,31) |
| InChIKey | GLCORQSYFVYIKY-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 55.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.54 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|