C23H21N3O — CID 27870739
1-[(2R)-2-(1H-indol-3-yl)-2-phenylethyl]-3-phenylurea (PubChem CID 27870739) has the molecular formula C23H21N3O and a molecular weight of 355.44 g/mol. Its IUPAC name is 1-[(2R)-2-(1H-indol-3-yl)-2-phenylethyl]-3-phenylurea.
| Compound Name | 1-[(2R)-2-(1H-indol-3-yl)-2-phenylethyl]-3-phenylurea |
|---|---|
| PubChem CID | 27870739 |
| Molecular Formula | C23H21N3O |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.17 |
| IUPAC Name | 1-[(2R)-2-(1H-indol-3-yl)-2-phenylethyl]-3-phenylurea |
| SMILES | O=C(NC[C@H](c1ccccc1)c1c[nH]c2ccccc12)Nc1ccccc1 |
| InChI | InChI=1S/C23H21N3O/c27-23(26-18-11-5-2-6-12-18)25-15-20(17-9-3-1-4-10-17)21-16-24-22-14-8-7-13-19(21)22/h1-14,16,20,24H,15H2,(H2,25,26,27)/t20-/m1/s1 |
| InChIKey | XAJROUBTHVWPNX-HXUWFJFHSA-N |
| XLogP | 5.12 |
| TPSA | 56.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |