C24H23N3O2 — CID 40880801
1-[(2S)-2-(1H-indol-3-yl)-2-(4-methoxyphenyl)ethyl]-3-phenylurea (PubChem CID 40880801) has the molecular formula C24H23N3O2 and a molecular weight of 385.47 g/mol. Its IUPAC name is 1-[(2S)-2-(1H-indol-3-yl)-2-(4-methoxyphenyl)ethyl]-3-phenylurea.
| Compound Name | 1-[(2S)-2-(1H-indol-3-yl)-2-(4-methoxyphenyl)ethyl]-3-phenylurea |
|---|---|
| PubChem CID | 40880801 |
| Molecular Formula | C24H23N3O2 |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | 1-[(2S)-2-(1H-indol-3-yl)-2-(4-methoxyphenyl)ethyl]-3-phenylurea |
| SMILES | COc1ccc([C@H](CNC(=O)Nc2ccccc2)c2c[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C24H23N3O2/c1-29-19-13-11-17(12-14-19)21(22-16-25-23-10-6-5-9-20(22)23)15-26-24(28)27-18-7-3-2-4-8-18/h2-14,16,21,25H,15H2,1H3,(H2,26,27,28)/t21-/m0/s1 |
| InChIKey | MOWXBGNGGFBRME-NRFANRHFSA-N |
| XLogP | 5.13 |
| TPSA | 66.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |