C26H27N3O4 — CID 92876039
1-[(2R)-2-(1H-indol-3-yl)-2-phenylethyl]-3-(3,4,5-trimethoxyphenyl)urea (PubChem CID 92876039) has the molecular formula C26H27N3O4 and a molecular weight of 445.52 g/mol. Its IUPAC name is 1-[(2R)-2-(1H-indol-3-yl)-2-phenylethyl]-3-(3,4,5-trimethoxyphenyl)urea.
| Compound Name | 1-[(2R)-2-(1H-indol-3-yl)-2-phenylethyl]-3-(3,4,5-trimethoxyphenyl)urea |
|---|---|
| PubChem CID | 92876039 |
| Molecular Formula | C26H27N3O4 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | 1-[(2R)-2-(1H-indol-3-yl)-2-phenylethyl]-3-(3,4,5-trimethoxyphenyl)urea |
| SMILES | COc1cc(NC(=O)NC[C@H](c2ccccc2)c2c[nH]c3ccccc23)cc(OC)c1OC |
| InChI | InChI=1S/C26H27N3O4/c1-31-23-13-18(14-24(32-2)25(23)33-3)29-26(30)28-15-20(17-9-5-4-6-10-17)21-16-27-22-12-8-7-11-19(21)22/h4-14,16,20,27H,15H2,1-3H3,(H2,28,29,30)/t20-/m1/s1 |
| InChIKey | OPOBCPNPZOHZHL-HXUWFJFHSA-N |
| XLogP | 5.15 |
| TPSA | 84.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |