C27H29N3O3 — CID 92876005
1-[(2R)-2-(3,4-dimethoxyphenyl)-2-(1H-indol-3-yl)ethyl]-3-(2-ethylphenyl)urea (PubChem CID 92876005) has the molecular formula C27H29N3O3 and a molecular weight of 443.55 g/mol. Its IUPAC name is 1-[(2R)-2-(3,4-dimethoxyphenyl)-2-(1H-indol-3-yl)ethyl]-3-(2-ethylphenyl)urea.
| Compound Name | 1-[(2R)-2-(3,4-dimethoxyphenyl)-2-(1H-indol-3-yl)ethyl]-3-(2-ethylphenyl)urea |
|---|---|
| PubChem CID | 92876005 |
| Molecular Formula | C27H29N3O3 |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.22 |
| IUPAC Name | 1-[(2R)-2-(3,4-dimethoxyphenyl)-2-(1H-indol-3-yl)ethyl]-3-(2-ethylphenyl)urea |
| SMILES | CCc1ccccc1NC(=O)NC[C@H](c1ccc(OC)c(OC)c1)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C27H29N3O3/c1-4-18-9-5-7-11-23(18)30-27(31)29-16-21(19-13-14-25(32-2)26(15-19)33-3)22-17-28-24-12-8-6-10-20(22)24/h5-15,17,21,28H,4,16H2,1-3H3,(H2,29,30,31)/t21-/m1/s1 |
| InChIKey | HCYJUCNUBDRAEX-OAQYLSRUSA-N |
| XLogP | 5.70 |
| TPSA | 75.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |