C25H23F2N3O3 — CID 46354820
1-(2,5-difluorophenyl)-3-[2-(3,4-dimethoxyphenyl)-2-(1H-indol-3-yl)ethyl]urea (PubChem CID 46354820) has the molecular formula C25H23F2N3O3 and a molecular weight of 451.47 g/mol. Its IUPAC name is 1-(2,5-difluorophenyl)-3-[2-(3,4-dimethoxyphenyl)-2-(1H-indol-3-yl)ethyl]urea.
| Compound Name | 1-(2,5-difluorophenyl)-3-[2-(3,4-dimethoxyphenyl)-2-(1H-indol-3-yl)ethyl]urea |
|---|---|
| PubChem CID | 46354820 |
| Molecular Formula | C25H23F2N3O3 |
| Molecular Weight | 451.47 g/mol |
| Exact Mass | 451.17 |
| IUPAC Name | 1-(2,5-difluorophenyl)-3-[2-(3,4-dimethoxyphenyl)-2-(1H-indol-3-yl)ethyl]urea |
| SMILES | COc1ccc(C(CNC(=O)Nc2cc(F)ccc2F)c2c[nH]c3ccccc23)cc1OC |
| InChI | InChI=1S/C25H23F2N3O3/c1-32-23-10-7-15(11-24(23)33-2)18(19-14-28-21-6-4-3-5-17(19)21)13-29-25(31)30-22-12-16(26)8-9-20(22)27/h3-12,14,18,28H,13H2,1-2H3,(H2,29,30,31) |
| InChIKey | NSZJORFLKMXGSU-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 75.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.47 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |