C29H32N2O5 — CID 46521063
4-ethoxy-N-[2-(4-ethoxy-3-methoxyphenyl)-2-(1H-indol-3-yl)ethyl]-3-methoxybenzamide (PubChem CID 46521063) has the molecular formula C29H32N2O5 and a molecular weight of 488.58 g/mol. Its IUPAC name is 4-ethoxy-N-[2-(4-ethoxy-3-methoxyphenyl)-2-(1H-indol-3-yl)ethyl]-3-methoxybenzamide.
| Compound Name | 4-ethoxy-N-[2-(4-ethoxy-3-methoxyphenyl)-2-(1H-indol-3-yl)ethyl]-3-methoxybenzamide |
|---|---|
| PubChem CID | 46521063 |
| Molecular Formula | C29H32N2O5 |
| Molecular Weight | 488.58 g/mol |
| Exact Mass | 488.23 |
| IUPAC Name | 4-ethoxy-N-[2-(4-ethoxy-3-methoxyphenyl)-2-(1H-indol-3-yl)ethyl]-3-methoxybenzamide |
| SMILES | CCOc1ccc(C(=O)NCC(c2ccc(OCC)c(OC)c2)c2c[nH]c3ccccc23)cc1OC |
| InChI | InChI=1S/C29H32N2O5/c1-5-35-25-13-11-19(15-27(25)33-3)22(23-18-30-24-10-8-7-9-21(23)24)17-31-29(32)20-12-14-26(36-6-2)28(16-20)34-4/h7-16,18,22,30H,5-6,17H2,1-4H3,(H,31,32) |
| InChIKey | OLRMHZDPIVJDQL-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 81.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.58 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |